1-(3'-O-[4,4'-Dimethoxytrityl]-alpha-L-threofuranosyl)-thymine
1-(3'-O-[4,4'-Dimethoxytrityl]-alpha-L-threofuranosyl)-thymine is a nucleoside analog commonly used in the development of antiviral and antitumor drugs. It has been found to effectively treat viral infections such as HIV and hepatitis B or C, as well as different types of cancer. Its mechanism of action involves inhibiting viral replication and inducing apoptosis in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 325683-89-4 |
| Pricing | Inquire |
| Cas | 325683-89-4 |
| Molecular Weight | 530.57 |
| Molecular Formula | C30H30N2O7 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(CO2)OC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |