Epi-Galantamine N-Oxide
Introducing Epi-Galantamine N-Oxide is an intriguing compound extensively employed in the research of neurodegenerative afflictions, most notably Alzheimer's disease. This remarkable substance optimizes cognitive prowess and memory retention by acting as a potent acetylcholinesterase inhibitor, thereby bolstering the cerebral abundance of acetylcholine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 366485-18-9 |
| Pricing | Inquire |
| Cas | 366485-18-9 |
| Molecular Weight | 303.36 |
| Molecular Formula | C17H21NO4 |
| Canonical SMILES | C[N+]1(CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC)O)[O-] |