SF 2315 A
SF 2315 A is a quinone antibiotic produced by Excellospora viridilutea SF2315. It exhibits inhibitory effect against Avian myelobastosis virus reverse transcriptase with IC50 of 100 μg/mL. It has weak activity against gram-positive bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02445 |
| Pricing | Inquire |
| Cas | 114687-52-4 |
| Molecular Weight | 324.3 |
| Molecular Formula | C19H16O5 |
| Canonical SMILES | CC1=CC(=O)C2C3=C(CCC2(C1)O)C(=O)C4=C(C3=O)C=CC=C4O |