Thrombin Receptor Activator for Peptide TFA
Thrombin Receptor Activator for Peptide TFA is a thrombin receptor activator used in the research of coronary heart disease (CHD). The thrombin receptor is a G protein-coupled receptor involved in the regulation of thrombotic response.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016368 |
| Pricing | Inquire |
| Cas | 2554776-23-5 |
| Molecular Weight | 748.79 |
| Molecular Formula | C32H51F3N8O9 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)O)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CO)N.C(=O)(C(F)(F)F)O |