ML-7 hydrochloride
ML-7 Hcl is a cell-permeable, potent, reversible, ATP-competitive, and selective inhibitor of myosin light chain kinase (Ki = 300 nM). It also inhibt smooth-muscle myosin light chain kinase, protein kinase C (PKC) and cAMP-dependent protein kinase (PKA)
Supplier | BOC Sciences |
---|---|
Product # | 110448-33-4 |
Pricing | Inquire |
Cas | 110448-33-4 |
Molecular Weight | 452.74 |
Molecular Formula | C15H18ClIN2O2S |
Canonical SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CC=C3I.Cl |