Trimethoprim-[13C3]
Labelled Trimethoprim. Trimethoprim is a bacteriostatic antibiotic used mainly in the prophylaxis and treatment of urinary tract infections. It caused induction of DnaK, DnaJ, GroEL, ClpB, and IbpA/B Hsps. It binds to dihydrofolate reductase and inhibits the reduction of dihydrofolic acid (DHF) to tetrahydrofolic acid (THF).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007528 |
| Pricing | Inquire |
| Cas | 1189970-95-3 |
| Molecular Weight | 293.30 |
| Molecular Formula | C11[13C]3H18N4O3 |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N |