b-D-Galactose-sp-biotin
b-D-Galactose-sp-biotin, an essential biomolecular compound, serves as a pivotal tool in the realm of biomedical science for combating diverse diseases and disorders. With its distinctive role as a biomarker and labeling agent, this indispensable product finds its application in an array of biochemical and biotechnological domains. It plays a paramount role in facilitating the development of diagnostic apparatus, conducting comprehensive research, and formulating effective medications, specifically targeting galactose metabolism and its associated ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870891-13-7 |
| Pricing | Inquire |
| Cas | 870891-13-7 |
| Molecular Weight | 576.70 |
| Molecular Formula | C25H44N4O9S |
| Canonical SMILES | O=C1NC2CSC(CCCCC(=O)NCCCCCC(=O)NCCCOC3OC(CO)C(O)C(O)C3O)C2N1 |