Spirotryprostatin B
It is a mammalian cell cycle inhibitor produced by the strain of Aspergillus fumigatus. 12.5 μg/mL of Spirotryprostatin B can inhibit the G2/M phase of the cell cycle in tsFT210 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02932 |
| Pricing | Inquire |
| Cas | 182234-26-0 |
| Molecular Weight | 363.41 |
| Molecular Formula | C21H21N3O3 |
| Canonical SMILES | CC(=CC1C2(C=C3N1C(=O)C4CCCN4C3=O)C5=CC=CC=C5NC2=O)C |