4-Methoxyphenyl 3-O-benzyl-b-D-galactopyranoside
4-Methoxyphenyl 3-O-benzyl-b-D-galactopyranoside is a crucial compound extensively employed in the biomedical sector, showcasing remarkable inhibitory potential in research of diverse ailments encompassing cancer and inflammation. Its atypical molecular configuration facilitates precise interactions with target entities, propelling its ascent as a propitious contender for drug exploration and development within the realm of compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383905-60-0 |
| Pricing | Inquire |
| Cas | 383905-60-0 |
| Molecular Weight | 376.40 |
| Molecular Formula | C20H24O7 |
| Canonical SMILES | COC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)OCC3=CC=CC=C3)O |