5-Iodoarabinouridine
5-Iodoarabinouridine, a biomedical compound, displays remarkable potential for research of various diseases. Exerting its influence as an RNA research and development inhibitor, this compound takes center stage in the arena of cancer research. Its proficiency lies in the selective targeting of RNA molecules, effectively curbing the malignant growth and propagation of cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3052-06-0 |
| Pricing | Inquire |
| Cas | 3052-06-0 |
| Molecular Weight | 370.10 |
| Molecular Formula | C9H11IN2O6 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)I |