3,4-Cyclohexenoesculetin b-D-galactopyranoside
3,4-Cyclohexenoesculetin b-D-galactopyranoside, an incredibly potent compound widely utilized in the biomedical sector, exhibits extraordinary anti-inflammatory and antioxidant characteristics. Its outstanding prowess positions it as an ideal therapeutic option for an array of ailments, including arthritis and oxidative stress-related disorders. Promisingly, extensive research has diligently revealed its capacity for immune response modulation and the delivery of therapeutic advantages.
| Supplier | BOC Sciences |
|---|---|
| Product # | 182805-65-8 |
| Pricing | Inquire |
| Cas | 182805-65-8 |
| Molecular Weight | 394.37 |
| Molecular Formula | C19H22O9 |
| Canonical SMILES | C1CCC2=C(C1)C3=CC(=C(C=C3OC2=O)OC4C(C(C(C(O4)CO)O)O)O)O |