Synaptamide-[d4]
Synaptamide-[d4] is the labelled form of Synaptamide (Docosahexaenoyl Ethanolamide). Docosahexaenoyl ethanolamide (DHEA) is the ethanolamine amide of DHA that has been detected in both brain and retina. DHEA binds to the rat brain CB1 receptor with a Ki of 324 nM, which is approximately 10-fold higher than the Ki for AEA. It also inhibits shaker-related voltage-gated potassium channels in brain slightly better than AEA, with an IC50 of 1.5 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004515 |
| Pricing | Inquire |
| Cas | 946524-43-2 |
| Molecular Weight | 375.58 |
| Molecular Formula | C24H33D4NO2 |
| Canonical SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCO |