2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphino}-3,6-dimethoxy -2,4,6-triisopropyl-1,1-biphenyl
Catalyst for N-Arylation reactionsBuchwald Phosphine Ligands for chemical Synthesis
JackiePhos is a Buchwald's phosphine ligand which can be used for the:• glycosyl cross-coupling reaction of diaryliodonium triflates with anomeric stannanes to synthesize C-glycosides.• synthesis of gold-based catalyst complexes such as [Au(CH3CN)(JackiePhos)][SbF6] and [(JackiePhos)AuCl.• acylation of alkylcarbastannatranes.• synthesis of cyclic guanidines or cyclic ureas bearing dialkylaminomethyl groups in combination with Pd(acac)2 as a catalyst.
JackiePhos is a Buchwald's phosphine ligand which can be used for the:• glycosyl cross-coupling reaction of diaryliodonium triflates with anomeric stannanes to synthesize C-glycosides.• synthesis of gold-based catalyst complexes such as [Au(CH3CN)(JackiePhos)][SbF6] and [(JackiePhos)AuCl.• acylation of alkylcarbastannatranes.• synthesis of cyclic guanidines or cyclic ureas bearing dialkylaminomethyl groups in combination with Pd(acac)2 as a catalyst.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1160861-60-8 |
| Pricing | Inquire |
| Cas | 1160861-60-8 |
| Molecular Weight | 796.66 |
| Molecular Formula | C39H37F12O2P |
| Canonical SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2P(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F)OC)OC)C(C)C |