ALPHA-AMANITIN
α-Amanitin is produced by the strain of Amanita phalloides. It is highly toxic to humans and can cause salivation, vomiting, bleeding, diarrhea, cyanosis, muscle convulsions, spasms, and death. It is the principal toxin of several deadly poisonous mushrooms and exerts its toxic effects by inhibiting RNA polymerase II.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00665 |
| Pricing | Inquire |
| Cas | 23109-05-9 |
| Molecular Weight | 918.97 |
| Molecular Formula | C39H54N10O14S |
| Canonical SMILES | CCC(C)C1C(=O)NCC(=O)NC2CS(=O)C3=C(CC(C(=O)NCC(=O)N1)NC(=O)C(NC(=O)C4CC(CN4C(=O)C(NC2=O)CC(=O)N)O)C(C)C(CO)O)C5=C(N3)C=C(C=C5)O |