1-(b-D-Xylofuranosyl)-5-methyluracil
1-(b-D-Xylofuranosyl)-5-methyluracil is a biochemical agent used within the biomedical industry for the research and study of antiviral drugs. It's primarily utilized in the development and testing of treatments for viral diseases such as herpes and hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 52486-19-8 |
| Pricing | Inquire |
| Cas | 52486-19-8 |
| Molecular Weight | 258.23 |
| Molecular Formula | C10H14N2O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |