2'-Deoxy-5'-O-DMT-cytidine
2'-Deoxy-5'-O-DMT-cytidine, a significant and indispensable compound utilized extensively in the realm of biomedicine, finds its purpose deeply rooted in research and development. This pivotal product showcases its utmost importance when exploring the intricacies of nucleosides and nucleotides. Its exceptional structure and properties provide an invaluable pathway towards comprehending the synthesis and interactions of nucleic acids.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76512-82-8 |
| Pricing | Inquire |
| Cas | 76512-82-8 |
| Molecular Weight | 529.58 |
| Molecular Formula | C30H31N3O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=CC(=NC5=O)N)O |