Endophenazine A
It is produced by the strain of Streptomyces anulatus. It has activity against gram-positive bacteria and filamentous fungi such as mucor and Penicillium. Its weeding ability to Lemna minor is relatively low.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01227 |
| Pricing | Inquire |
| Cas | 86125-71-5 |
| Molecular Weight | 292.33 |
| Molecular Formula | C18H16N2O2 |
| Canonical SMILES | CC(=CCC1=C2C(=CC=C1)N=C3C=CC=C(C3=N2)C(=O)O)C |