Tolmetin (Ethyl Ester-[d3])
Tolmetin (Ethyl Ester-[d3]) is a labelled intermediate for the preparation of Tolmetin. Tolmetin, belonging to heterocyclic acetic acid derivative class, is a non-steroidal anti-inflammatory drug that can increase the risk of heart or circulatory conditions such as heart attacks and strokes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007470 |
| Pricing | Inquire |
| Cas | 1215579-60-4 |
| Molecular Weight | 288.36 |
| Molecular Formula | C17H16D3NO3 |
| Canonical SMILES | CCOC(=O)CC1=CC=C(N1C)C(=O)C2=CC=C(C=C2)C |