3'-O-(4,4'-Dimethoxytrityl)-thymidine-5'-cyanoethyl-Phosphoramidite
3'-O-(4,4'-Dimethoxytrityl)-thymidine-5'-cyanoethyl-Phosphoramidite is a phosphoramidite used in the synthesis of oligonucleotides. It is specifically designed for use in automated oligonucleotide synthesis systems, ensuring precise and controlled addition of thymidine units in the synthesis of custom DNA sequences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 134031-86-0 |
| Pricing | Inquire |
| Cas | 134031-86-0 |
| Molecular Weight | 744.81 |
| Molecular Formula | C40H49N4O8P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(N(C(C)C)C(C)C)OCCC#N)OC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |