Methyl 6-(Bromomethyl)-5-fluoronicotinate
Methyl 6-(Bromomethyl)-5-fluoronicotinate is a derivative of 5- Bromo- 6- (bromomethyl) - 3- pyridinecarboxylic Acid Methyl Ester (CAS# 1379310-09-4), which is a useful reactant for preparing tricyclic compounds as FXR modulators for treatment of FXR-mediated disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058974 |
| Pricing | Inquire |
| Molecular Weight | 248.05 |
| Molecular Formula | C8H7BrFNO2 |
| Canonical SMILES | COC(=O)C1=CC(=C(N=C1)CBr)F |