2',3',5'-Tri-O-acetyl-5-(trifluoromethyl)uridine
2',3',5'-Tri-O-acetyl-5-(trifluoromethyl)uridine, a synthetically derived nucleoside analogue with significant implications for biomedical research, has been utilized in the investigation and remediation of viral infections including hepatitis C and herpes. Additionally, preclinical evaluations have suggested promising anti-tumor activity associated with this unique compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84500-34-5 |
| Pricing | Inquire |
| Cas | 84500-34-5 |
| Molecular Weight | 438.31 |
| Molecular Formula | C16H17F3N2O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=C(C(=O)NC2=O)C(F)(F)F)OC(=O)C)OC(=O)C |