2',3',5'-Tri-O-(p-chlorobenzoyl)-5-azacytidine
2',3',5'-Tri-O-(p-chlorobenzoyl)-5-azacytidine, an immensely powerful and discriminative antineoplastic compound, finds its application in the therapeutic regimen of diverse malignancies such as leukemia and myelodysplastic syndromes. By impeding DNA methyltransferase, this agent instigates DNA hypomethylation and reawakens dormant tumor suppressor genes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 158778-00-8 |
| Pricing | Inquire |
| Cas | 158778-00-8 |
| Molecular Weight | 659.86 |
| Molecular Formula | C29H21Cl3N4O8 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)OCC2C(C(C(O2)N3C=NC(=NC3=O)N)OC(=O)C4=CC=C(C=C4)Cl)OC(=O)C5=CC=C(C=C5)Cl)Cl |