Methyl 2-O-allyl-4,6-O-benzylidene-3-O-(2,3,4,6-tetra-O-acetyl-a-D-mannopyranosyl)-a-D-mannopyranoside
Methyl 2-O-allyl-4,6-O-benzylidene-3-O-(2,3,4,6-tetra-O-acetyl-a-D-mannopyranosyl)-a-D-mannopyranoside, a remarkable biomedical compound, stands as an intricate solution in the fight against cancer and infectious diseases. Its exceptional ability to curb cancer cell proliferation and hinder the growth of diverse pathogens highlights its immense therapeutic potential in combating drug-resistant malignancies and microbial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82185-93-1 |
| Pricing | Inquire |
| Cas | 82185-93-1 |
| Molecular Weight | 652.64 |
| Molecular Formula | C31H40O15 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C3C(COC(O3)C4=CC=CC=C4)OC(C2OCC=C)OC)OC(=O)C)OC(=O)C)OC(=O)C |