c-Kit-IN-3
c-Kit-IN-3 is a selective inhibitor of c-KIT kinase. c-Kit-IN-3 displays great potencies against most of the gain-of function mutations in the juxtamembrane domain, drugresistant mutations in the ATP binding pocket, and activation loops.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2363169-01-9 |
| Pricing | Inquire |
| Cas | 2363169-01-9 |
| Molecular Weight | 516.90 |
| Molecular Formula | C26H20ClF3N2O4 |
| Canonical SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)CC4=CC(=C(C=C4)Cl)C(F)(F)F |