TML-6
TML-6 is an orally active curcumin derivative that inhibits the synthesis of the β-amyloid precursor protein and β-amyloid (Aβ). TML-6 can upregulate Apo E, suppress NF-κB and mTOR, and increase the activity of the anti-oxidative Nrf2 gene.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1462868-88-7 |
| Pricing | Inquire |
| Cas | 1462868-88-7 |
| Molecular Weight | 523.62 |
| Molecular Formula | C30H37NO7 |
| Canonical SMILES | CCN(CC)C(=O)CC(C)(C(=O)C=CC1=CC(=C(C=C1)OC)OC)C(=O)C=CC2=CC(=C(C=C2)OC)OC |