Clenbuterol EP Impurity B HCl
Clenbuterol EP Impurity B HCl is an impurity of Clenbuterol and is used as a reagent in the synthesis of pyrazolopyridine derivatives as inhibitors of phosphodiesterase-4 (PDE-IV) and production of tumor necrosis factor-α (TNF-α).
| Supplier | BOC Sciences |
|---|---|
| Product # | 37845-71-9 |
| Pricing | Inquire |
| Cas | 37845-71-9 |
| Molecular Weight | 311.63 |
| Molecular Formula | C12H17Cl3N2O |
| Canonical SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C(=C1)Cl)N)Cl.Cl |