Adenosine 5'-diphosphate monopotassium salt
Adenosine 5'-diphosphate (ADP) is an adenine nucleotide containing two phosphate groups esterified to the sugar moiety at the 5' position. It is produced by dephosphorylation of adenosine 5'-triphosphate by ATPases and can be converted back to ATP by ATP synthases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70285-70-0 |
| Pricing | Inquire |
| Cas | 70285-70-0 |
| Molecular Weight | 465.29 |
| Molecular Formula | C10H14KN5O10P2 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)[O-])O)N.[K+] |