N-1-b-D-Arabinopyranosylamino guanidine HNO3
N-1-b-D-Arabinopyranosylamino guanidine HNO3, a newly discovered compound, has garnered significant attention in the field of biomedicine due to its potential therapeutic applications in diverse disease treatments. Research conducted thus far suggests its efficacy in impeding the proliferation of malignant cells, highlighting its role in the development of targeted cancer therapies. Furthermore, this compound exhibits remarkable antimicrobial properties, rendering it a plausible weapon against bacterial infections.
Supplier | BOC Sciences |
---|---|
Product # | 368452-60-2 |
Pricing | Inquire |
Cas | 368452-60-2 |
Molecular Weight | 269.21 |
Molecular Formula | C6H15N5O7 |
Canonical SMILES | C1C(C(C(C(O1)NN=C(N)N)O)O)O.[N+](=O)(O)[O-] |