2-Fluoro-3-(tributylstannyl)pyridine
2-Fluoro-3-(tributylstannyl)pyridine is a specialized organotin compound frequently in medicinal chemistry. Principally, it's used to facilitate palladium-catalyzed processes like Stille coupling, instrumental in the synthesis of various pharmaceuticals, including anti-cancer and anti-viral drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 155533-81-6 |
| Pricing | Inquire |
| Cas | 155533-81-6 |
| Molecular Weight | 386.12 |
| Molecular Formula | C17H30FNSn |
| Canonical SMILES | CCCC[Sn](CCCC)(CCCC)C1=C(N=CC=C1)F |