3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-5-fluoro-arabinouridine
3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-5-fluoro-arabinouridine, a highly potent antiviral agent employed in the biomedical sector, showcases remarkable efficacy against a diverse array of RNA viruses, encompassing influenza, hepatitis C, and respiratory syncytial virus. By impeding viral RNA synthesis, this compound effectively disrupts viral replication, thereby unveiling its tremendous potential as a therapeutic option for combatting viral ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 952651-49-9 |
| Pricing | Inquire |
| Cas | 952651-49-9 |
| Molecular Weight | 472.40 |
| Molecular Formula | C23H18F2N2O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)F)F)OC(=O)C4=CC=CC=C4 |