1-Methyladenosine
1-Methyladenosine is a modified nucleoside often found in tRNAs and rRNA. In the biomedical industry, it is pivotal for protein synthesis, cellular function, and responses to stressors. It's also being studied concerning viral RNA methylation in diseases such as hepatitis C.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-363540 |
| Pricing | Inquire |
| Cas | 15763-06-1 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CN1C=NC2=C(C1=N)N=CN2C3C(C(C(O3)CO)O)O |