3'-Azido-2',3'-dideoxyguanosine
3'-Azido-2',3'-dideoxyguanosine is a potent antiviral medication used in the treatment of HIV/AIDS. It inhibits reverse transcriptase and prevents the replication of the virus by terminating DNA chain elongation. Its unique structure allows it to selectively target viral DNA synthesis while minimizing toxicity to healthy human cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66323-46-4 |
| Pricing | Inquire |
| Cas | 66323-46-4 |
| Molecular Weight | 292.25 |
| Molecular Formula | C10H12N8O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)N=[N+]=[N-] |