Daunorubicin EP Impurity F
Daunorubicin EP Impurity F is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 771423-67-7 |
| Pricing | Inquire |
| Cas | 771423-67-7 |
| Molecular Weight | 541.55 |
| Molecular Formula | C28H31NO10 |
| Canonical SMILES | CCC(=O)C1(CC(C2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4OC)O)OC5CC(C(C(O5)C)O)N)O |