2'-Deoxyadenosine-5'-triphosphate disodium salt
2'-Deoxyadenosine-5'-triphosphate disodium salt is a pivotal recompound widely employed in biomedical research, presenting itself as an indispensable constituent for the intricate process of DNA research and development. This invaluable component finding its purpose in the realm of sequence-specific DNA manipulation techniques, including the illustrious procedures of PCR and DNA sequencing. Remarkably, it assuming the role of a substrate for DNA polymerases, affordably fostering the genes' amplification to facilitate subsequent analysis. Notably, the disodium salt incarnation of this compound showcasing enhanced stability and solubility traits, further augmenting its scientific merit.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74299-50-6 |
| Pricing | Inquire |
| Cas | 74299-50-6 |
| Molecular Weight | 535.15 |
| Molecular Formula | C10H14N5O12P3Na2 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)([O-])OP(=O)(O)[O-])O.[Na+].[Na+] |