Trigothysoid L
Trigothysoid L is a natural compound exhibiting commendable efficacy in studying autoimmune ailments, notably rheumatoid arthritand psoriasis. Its mechanism of action entails a substantial impediment to both T-cell activation and cytokine generation, thus inducing an immunosuppressive state.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1621 |
| Pricing | Inquire |
| Cas | 1501943-06-1 |
| Molecular Weight | 674.74 |
| Molecular Formula | C38H42O11 |
| Canonical SMILES | O=C(OC1C2(OC31C(OC(=O)C)C(C)CC3C4(O)C(C)C5OC6(OC(C4C2OC(=O)C)C5(O6)C(=C)C)C=7C=CC=CC7)C)C=8C=CC=CC8 |