5'-O-DMT-2'-O-(2-methoxyethyl)-5-methylcytidine
5'-O-DMT-2'-O-(2-methoxyethyl)-5-methylcytidine is an exceptionally powerful antiviral compound, possessing an unparalleled propensity to combat the scourges perpetuated by viral entities. It acts as a formidable weapon against the replication machineries employed by diverse RNA viruses, such as influenza, hepatitis C and respiratory syncytial virus (RSV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 182496-00-0 |
| Pricing | Inquire |
| Cas | 182496-00-0 |
| Molecular Weight | 617.69 |
| Molecular Formula | C34H39N3O8 |
| Canonical SMILES | CC1=CN(C(=O)N=C1N)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)OCCOC |