2,6-Difluorobenzenesulfonyl chloride
2,6-Difluorobenzenesulfonyl chloride (CAS# 60230-36-6) is used as a reagent to synthesize Dabrafenib, an inhibitor of BRAF kinase that is used to treat BRAF V600-mutation positive carcinoma. BRAF is a gene that mediates cell growth and is activated by mutations caused by cancer. 2,6-Difluorobenzenesulfonyl chloride is also a potential inhibitor of zinc proteases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60230-36-6 |
| Pricing | Inquire |
| Cas | 60230-36-6 |
| Molecular Weight | 212.60 |
| Molecular Formula | C6H3ClF2O2S |
| Canonical SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)F |