Fmoc-Val-Ala-Gly-OH
Fmoc-Val-Ala-Gly-OH is a noteworthy peptide in the realm of biomedicine and stands out as a pivotal player in combating a myriad of ailments. Its distinctive amalgamation of amino acids not only showcases formidable potential in intricately honing drug delivery mechanisms but also towards the noble pursuit of alleviating cancerous maladies and grappling with autoimmune disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01484 |
| Pricing | Inquire |
| Cas | 2377585-15-2 |
| Molecular Weight | 467.51 |
| Molecular Formula | C25H29N3O6 |
| Canonical SMILES | CC(C)C(C(=O)NC(C)C(=O)NCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |