4-(Diethylphosphino)-N,N-dimethylaniline
4-(Diethylphosphino)-N,N-dimethylaniline is a fundamental compound extensively employed in the synthesis of diverse pharmaceuticals for the biomedical sector. Its inclusion of a phosphine entity assumes a pivotal position as a ligand within catalytic pathways, facilitating the establishment of carbon-carbon interactions. Notably, this exceptional entity embraces profound implications in the realm of medicinal chemistry, empowering the development of therapeutic agents targeting a spectrum of ailments and disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17005-57-1 |
| Pricing | Inquire |
| Cas | 17005-57-1 |
| Molecular Weight | 209.27 |
| Molecular Formula | C12H20NP |
| Canonical SMILES | CCP(CC)C1=CC=C(C=C1)N(C)C |