6-Bromo-2-naphthyl b-D-xylopyranoside
6-Bromo-2-naphthyl b-D-xylopyranoside is a vital compound used in biomedical research. It acts as a substrate in enzymatic studies to investigate the metabolism of xylopyranose and its derivatives. This product holds immense potential in the development of drugs targeting metabolic disorders and related diseases, such as diabetes and obesity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69594-75-8 |
| Pricing | Inquire |
| Cas | 69594-75-8 |
| Molecular Weight | 355.18 |
| Molecular Formula | C15H15BrO5 |
| Canonical SMILES | C1C(C(C(C(O1)OC2=CC3=C(C=C2)C=C(C=C3)Br)O)O)O |