Ferulic acid-1,2,3-[13C3]
Ferulic acid-1,2,3-[13C3] is the labelled analogue of Ferulic Acid. Ferulic Acid is a hydroxycinnamic acid and a type of organic compound found in the Ferula assafoetida L. or Ligusticum chuanxiong. It has many functions such as antioxidant, antimicrobial, anti-inflammatory, anti-thrombosis, anti-diabetic, and anti-cancer activities. Ferulic acid can be used in cosmetics material.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000565 |
| Pricing | Inquire |
| Cas | 1261170-81-3 |
| Molecular Weight | 197.16 |
| Molecular Formula | C7[13C]3H10O4 |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)O)O |