9-(2',3',5'-Tri-O-benzyl-b-D-arabinofuranosyl)adenine
9-(2',3',5'-Tri-O-benzyl-b-D-arabinofuranosyl)adenine, commonly known as TBA, is an immensely powerful antiviral compound that displays inhibitory efficacy in research of a wide array of malignancies such as leukemia, lymphoma and solid tumors. By obstructing the propagation of viral DNA and RNA, this pharmacological compound successfully impedes the proliferation and dissemination of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3257-73-6 |
| Pricing | Inquire |
| Cas | 3257-73-6 |
| Molecular Weight | 537.61 |
| Molecular Formula | C31H31N5O4 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(O2)N3C=NC4=C(N=CN=C43)N)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |