N3-Methylthymidine
N3-Methylthymidine is a crucial element employed in the biomedical sector for the synthesis of nucleoside analogs. Its widespread adoption in antiviral drug formulation and cancer investigation contributes to the research of viral afflictions and diverse malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 958-74-7 |
| Pricing | Inquire |
| Cas | 958-74-7 |
| Molecular Weight | 256.26 |
| Molecular Formula | C11H16N2O5 |
| Canonical SMILES | CC1=CN(C(=O)N(C1=O)C)C2CC(C(O2)CO)O |