4',5'-Didehydro-2',5'-dideoxy-2'-fluorouridine
4',5'-Didehydro-2',5'-dideoxy-2'-fluorouridine, an influential antiviral agent, exhibits exceptional efficacy against a spectrum of viral ailments encompassing hepatitis C and HIV. It exerts its prohibition on viral RNA production and duplication, thereby effectively hindering the advancement of these afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1365255-75-9 |
| Pricing | Inquire |
| Cas | 1365255-75-9 |
| Molecular Weight | 228.18 |
| Molecular Formula | C9H9FN2O4 |
| Canonical SMILES | C=C1C(C(C(O1)N2C=CC(=O)NC2=O)F)O |