Pomalidomide-PEG4-C2-NH2 hydrochloride
Pomalidomide-PEG4-C2-NH2 hydrochloride is a synthetic E3 ligase ligand-linker conjugate containing a cereblon ligand based on Pomalidomide and a PEG linker of 4 O(CH2)2 units with terminal amine, as a part of a variety of functionalized PROTAC molecules for binding to a target protein ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-100116 |
| Pricing | Inquire |
| Cas | 2357105-92-9 |
| Molecular Weight | 528.98 |
| Molecular Formula | C₂₃H₃₃ClN₄O₈ |
| Canonical SMILES | O=C(N(C(C1=CC=C2)=O)C3CCC(NC3=O)=O)C1=C2NCCOCCOCCOCCOCCN.Cl |