2'-O-Methylisocytidine
2'-O-Methylisocytidine, a fundamental compound utilized in the biomedical sector for the pursuit of scientific advancements, emerges as a pivotal entity. Profoundly impacting the exploration of RNA adjustments and nucleic acid chemistry, it attains a remarkable position.
Supplier | BOC Sciences |
---|---|
Product # | 175471-65-5 |
Pricing | Inquire |
Cas | 175471-65-5 |
Molecular Weight | 257.24 |
Molecular Formula | C10H15N3O5 |
Canonical SMILES | COC1C(C(OC1N2C=CC(=O)N=C2N)CO)O |