A 438079 hydrochloride
A 438079 hydrochloride is a competitive P2X7 receptor antagonist with pIC50 value of 6.9 for the inhibition of Ca2+ influx in the human recombinant P2X7 cell line. It protects against acetaminophen-induced liver injury by inhibiting p450 isoenzymes, but not by inflammasome activation. It partially but significantly prevented the 6-OHDA-induced depletion of striatal DA stores.
| Supplier | BOC Sciences |
|---|---|
| Product # | 899507-36-9 |
| Pricing | Inquire |
| Cas | 899507-36-9 |
| Molecular Weight | 342.61 |
| Molecular Formula | C13H10Cl3N5 |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=NN2CC3=CN=CC=C3.Cl |