Asperulosidic acid
Asperulosidic acid is a naturally occurring compound abundant in diverse plants, garnering immense interest due to its remarkable pharmacological activities. Its anti-inflammatory and antioxidant attributes have propelled its prominence in the biomedical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 25368-11-0 |
| Pricing | Inquire |
| Cas | 25368-11-0 |
| Molecular Weight | 432.4 |
| Molecular Formula | C18H24O12 |
| Canonical SMILES | CC(=O)OCC1=CC(C2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)CO)O)O)O)O |