Pillaromycin A
It is produced by the strain of Str. flavovirens 65786. It has anti-mycobacteria, gram-positive bacteria and gram-negative bacteria effects, but the effect of anti-gram-negative bacteria is weak. It also has antitumor activity similar to colchicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 30361-37-6 |
| Pricing | Inquire |
| Cas | 30361-37-6 |
| Molecular Weight | 542.53 |
| Molecular Formula | C28H30O11 |
| Canonical SMILES | CC1C(CCC(O1)OC23C=C(C(C(C2CC4=C(C3=O)C(=C5C(=C4)C=CC=C5O)O)O)O)C(=O)C)(C(=O)CO)O |