Sennoside A
Sennoside A, a kind of irritant laxative isolated from rhei rhizome, causes purgative actions in the intestine. Sennoside A can be used in health products. It is an HIV-1 inhibitor that is effective against HIV-1 replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81-27-6 |
| Pricing | Inquire |
| Cas | 81-27-6 |
| Molecular Weight | 862.74 |
| Molecular Formula | C42H38O20 |
| Canonical SMILES | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)OC7C(C(C(C(O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O |